Products 2940870-49-3
CAS 2940870-49-3 is the registry number for endo-8-oxa-3-azabicyclo[3.2.1]octane-2-carboxylic acid,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(1R,2R,5S)-8-oxa-3-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride (CAS 2940870-49-3) is a chemical compound with the molecular formula C7H12ClNO3 and a molecular weight of 193.63 g/mol. IUPAC name: (1R,2R,5S)-8-oxa-3-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride. InChIKey: BUSQEUYQYKHXKM-FPKZOZHISA-N.
| Molecular formula | C7H12ClNO3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | (1R,2R,5S)-8-oxa-3-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride |
| InChIKey | BUSQEUYQYKHXKM-FPKZOZHISA-N |
| SMILES | C1C[C@@H]2[C@@H](NC[C@H]1O2)C(=O)O.Cl |
Computed by PubChem (NCBI)