Products 2940879-34-3
CAS 2940879-34-3 is the registry number for [(1R,5R,7S)-4-oxa-1-azabicyclo[3.2.1]octan-7-yl]methanol,hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
[(5R,7S)-4-oxa-1-azabicyclo[3.2.1]octan-7-yl]methanol;hydrochloride (CAS 2940879-34-3) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: [(5R,7S)-4-oxa-1-azabicyclo[3.2.1]octan-7-yl]methanol;hydrochloride. InChIKey: IGSKQDNDLUPFQJ-UOERWJHTSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | [(5R,7S)-4-oxa-1-azabicyclo[3.2.1]octan-7-yl]methanol;hydrochloride |
| InChIKey | IGSKQDNDLUPFQJ-UOERWJHTSA-N |
| SMILES | C1CO[C@@H]2C[C@H](N1C2)CO.Cl |
Computed by PubChem (NCBI)