Products 2940934-88-1
CAS 2940934-88-1 is the registry number for 4-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)oxy)butanoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxybutanoic acid (CAS 2940934-88-1) is a chemical compound with the molecular formula C17H16N2O7 and a molecular weight of 360.3 g/mol. IUPAC name: 4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxybutanoic acid. InChIKey: LYCULVCGVDWCDS-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O7 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxybutanoic acid |
| InChIKey | LYCULVCGVDWCDS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)OCCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Thalidomide-5-O-C3-COOH, Thalidomide-5'-O-C3-acid