Products 2940944-76-1
CAS 2940944-76-1 is the registry number for 6-bromo-4,4-difluoro-isoquinolin-3-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
6-bromo-4,4-difluoroisoquinolin-3-one (CAS 2940944-76-1) is a chemical compound with the molecular formula C9H4BrF2NO and a molecular weight of 260.03 g/mol. IUPAC name: 6-bromo-4,4-difluoroisoquinolin-3-one. InChIKey: DJQNNYPRCKMGOA-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF2NO |
|---|---|
| Molecular weight | 260.03 g/mol |
| IUPAC name | 6-bromo-4,4-difluoroisoquinolin-3-one |
| InChIKey | DJQNNYPRCKMGOA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(C(=O)N=C2)(F)F |
Computed by PubChem (NCBI)