Products 2940956-38-5
CAS 2940956-38-5 is the registry number for [2-chloro-5-[(4-isopropylphenyl)methylamino]phenyl]methanol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
[2-chloro-5-[(4-propan-2-ylphenyl)methylamino]phenyl]methanol (CAS 2940956-38-5) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: [2-chloro-5-[(4-propan-2-ylphenyl)methylamino]phenyl]methanol. InChIKey: UFVVZJASNSKCAA-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | [2-chloro-5-[(4-propan-2-ylphenyl)methylamino]phenyl]methanol |
| InChIKey | UFVVZJASNSKCAA-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CNC2=CC(=C(C=C2)Cl)CO |
Computed by PubChem (NCBI)