Products 2940957-12-8
CAS 2940957-12-8 is the registry number for 4,6-dichloro-2-methyl-pyrazolo[3,4-b]pyridine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
4,6-dichloro-2-methylpyrazolo[3,4-b]pyridine (CAS 2940957-12-8) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 4,6-dichloro-2-methylpyrazolo[3,4-b]pyridine. InChIKey: LONNTONSQMIZLH-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 4,6-dichloro-2-methylpyrazolo[3,4-b]pyridine |
| InChIKey | LONNTONSQMIZLH-UHFFFAOYSA-N |
| SMILES | CN1C=C2C(=CC(=NC2=N1)Cl)Cl |
Computed by PubChem (NCBI)