Products 2940957-41-3
CAS 2940957-41-3 is the registry number for 6-Chloro-1-(tetrahydro-2H-pyran-2-yl)-1H-indazole-4-carbaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
6-chloro-1-(oxan-2-yl)indazole-4-carbaldehyde (CAS 2940957-41-3) is a chemical compound with the molecular formula C13H13ClN2O2 and a molecular weight of 264.71 g/mol. IUPAC name: 6-chloro-1-(oxan-2-yl)indazole-4-carbaldehyde. InChIKey: BQCDOPHRMAUSKD-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O2 |
|---|---|
| Molecular weight | 264.71 g/mol |
| IUPAC name | 6-chloro-1-(oxan-2-yl)indazole-4-carbaldehyde |
| InChIKey | BQCDOPHRMAUSKD-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC(=CC(=C3C=N2)C=O)Cl |
Computed by PubChem (NCBI)