Products 2940957-95-7

CAS 2940957-95-7 is the registry number for Dimethyl 2-oxabicyclo[2.2.2]octane-1,4-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Dimethyl 2-oxabicyclo[2.2.2]octane-1,4-dicarboxylate (CAS 2940957-95-7) is a chemical compound with the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. IUPAC name: dimethyl 2-oxabicyclo[2.2.2]octane-1,4-dicarboxylate. InChIKey: VFAYVSFMKTYMPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16O5
Molecular weight228.24 g/mol
IUPAC namedimethyl 2-oxabicyclo[2.2.2]octane-1,4-dicarboxylate
InChIKeyVFAYVSFMKTYMPQ-UHFFFAOYSA-N
SMILESCOC(=O)C12CCC(CC1)(OC2)C(=O)OC

Computed by PubChem (NCBI)