CAS 29412-62-2 appears in our catalog under these names: Dimethyl Cubane–1,4–dicarboxylate, Dimethyl 1,4-cubanedicarboxylate, Dimethyl Cubane-1,4-dicarboxylate, >98.0%(GC), Dimethyl cubane-1,4-dicarboxylate 98%, DIMETHYL 1,4-CUBANEDICARBOXYLATE, 97%, 97%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 2g, 5g, 10g, 25g, 50g.
Dimethyl cubane-1,4-dicarboxylate (CAS 29412-62-2) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: dimethyl cubane-1,4-dicarboxylate. InChIKey: OXBMFCGRQJNAOY-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | dimethyl cubane-1,4-dicarboxylate |
| InChIKey | OXBMFCGRQJNAOY-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45C(=O)OC |
Computed by PubChem (NCBI)