Products 294181-98-9

CAS 294181-98-9 is the registry number for Ethyl 2,2-difluoro-2-(pyrimidin-2-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2,2-difluoro-2-pyrimidin-2-ylacetate (CAS 294181-98-9) is a chemical compound with the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. IUPAC name: ethyl 2,2-difluoro-2-pyrimidin-2-ylacetate. InChIKey: XZZQVDKUVZPVOO-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8F2N2O2
Molecular weight202.16 g/mol
IUPAC nameethyl 2,2-difluoro-2-pyrimidin-2-ylacetate
InChIKeyXZZQVDKUVZPVOO-UHFFFAOYSA-N
SMILESCCOC(=O)C(C1=NC=CC=N1)(F)F

Computed by PubChem (NCBI)