CAS 2942-03-2 is the registry number for 2,3-Dimethyl-6-nitroquinoxaline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,3-dimethyl-6-nitroquinoxaline (CAS 2942-03-2) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 2,3-dimethyl-6-nitroquinoxaline. InChIKey: XDRSTGHGOVMLRX-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 2,3-dimethyl-6-nitroquinoxaline |
| InChIKey | XDRSTGHGOVMLRX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C2C=C(C=CC2=N1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)