Products 2948106-04-3
CAS 2948106-04-3 is the registry number for N-Butyl-2,3-dichlorobenzenesulfonamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N-butyl-2,3-dichlorobenzenesulfonamide (CAS 2948106-04-3) is a chemical compound with the molecular formula C10H13Cl2NO2S and a molecular weight of 282.19 g/mol. IUPAC name: N-butyl-2,3-dichlorobenzenesulfonamide. InChIKey: SYXUPTBYUTYBQN-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2S |
|---|---|
| Molecular weight | 282.19 g/mol |
| IUPAC name | N-butyl-2,3-dichlorobenzenesulfonamide |
| InChIKey | SYXUPTBYUTYBQN-UHFFFAOYSA-N |
| SMILES | CCCCNS(=O)(=O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)