Products 294878-00-5
CAS 294878-00-5 is the registry number for 3-Amino-5-chloro-1-benzofuran-2-carboxamide, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
3-amino-5-chloro-1-benzofuran-2-carboxamide (CAS 294878-00-5) is a chemical compound with the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. IUPAC name: 3-amino-5-chloro-1-benzofuran-2-carboxamide. InChIKey: DSULSHPYVGTEJW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O2 |
|---|---|
| Molecular weight | 210.62 g/mol |
| IUPAC name | 3-amino-5-chloro-1-benzofuran-2-carboxamide |
| InChIKey | DSULSHPYVGTEJW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=C(O2)C(=O)N)N |
Computed by PubChem (NCBI)