Products 2953023-85-1
CAS 2953023-85-1 is the registry number for DNA polymerase-IN-4. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[3-(oxiran-2-yl)propoxy]chromen-2-one (CAS 2953023-85-1) is a chemical compound with the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. IUPAC name: 7-[3-(oxiran-2-yl)propoxy]chromen-2-one. InChIKey: KOOIXRMLUYQVIQ-UHFFFAOYSA-N.
| Molecular formula | C14H14O4 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 7-[3-(oxiran-2-yl)propoxy]chromen-2-one |
| InChIKey | KOOIXRMLUYQVIQ-UHFFFAOYSA-N |
| SMILES | C1C(O1)CCCOC2=CC3=C(C=C2)C=CC(=O)O3 |
Computed by PubChem (NCBI)
Synonyms:
DNA polymerase-IN-4