Products 296888-45-4
CAS 296888-45-4 is the registry number for TrkA-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-methyl-2-[5-(2-nitrophenyl)-1H-pyrazol-3-yl]phenol (CAS 296888-45-4) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 295.29 g/mol. IUPAC name: 4-methyl-2-[5-(2-nitrophenyl)-1H-pyrazol-3-yl]phenol. InChIKey: AWWJDMCIECLYAS-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 4-methyl-2-[5-(2-nitrophenyl)-1H-pyrazol-3-yl]phenol |
| InChIKey | AWWJDMCIECLYAS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)C2=NNC(=C2)C3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)