Products 2969327-02-2
CAS 2969327-02-2 is the registry number for (4-chloro-2,3-difluorophenyl)(phenyl)methanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-chloro-2,3-difluorophenyl)-phenylmethanol (CAS 2969327-02-2) is a chemical compound with the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. IUPAC name: (4-chloro-2,3-difluorophenyl)-phenylmethanol. InChIKey: BZXPVSLRQWOGKH-UHFFFAOYSA-N.
| Molecular formula | C13H9ClF2O |
|---|---|
| Molecular weight | 254.66 g/mol |
| IUPAC name | (4-chloro-2,3-difluorophenyl)-phenylmethanol |
| InChIKey | BZXPVSLRQWOGKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C(=C(C=C2)Cl)F)F)O |
Computed by PubChem (NCBI)