Products 2969410-54-4
CAS 2969410-54-4 is the registry number for 5-bromo-8-chloro-2,3-dihydrobenzo[b][1,4]dioxine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-8-chloro-2,3-dihydro-1,4-benzodioxine (CAS 2969410-54-4) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 5-bromo-8-chloro-2,3-dihydro-1,4-benzodioxine. InChIKey: JNTULRFJEOTKKP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 5-bromo-8-chloro-2,3-dihydro-1,4-benzodioxine |
| InChIKey | JNTULRFJEOTKKP-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C2O1)Cl)Br |
Computed by PubChem (NCBI)