Products 2969616-70-2
CAS 2969616-70-2 is the registry number for (E)-1-(4-(trifluoromethoxy)phenyl)but-2-en-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(E)-1-[4-(trifluoromethoxy)phenyl]but-2-en-1-ol (CAS 2969616-70-2) is a chemical compound with the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. IUPAC name: (E)-1-[4-(trifluoromethoxy)phenyl]but-2-en-1-ol. InChIKey: AJELXVRKQJCJJI-NSCUHMNNSA-N.
| Molecular formula | C11H11F3O2 |
|---|---|
| Molecular weight | 232.20 g/mol |
| IUPAC name | (E)-1-[4-(trifluoromethoxy)phenyl]but-2-en-1-ol |
| InChIKey | AJELXVRKQJCJJI-NSCUHMNNSA-N |
| SMILES | C/C=C/C(C1=CC=C(C=C1)OC(F)(F)F)O |
Computed by PubChem (NCBI)