Products 2973762-68-2
CAS 2973762-68-2 is the registry number for 6-(1-Aminoethyl)pyridin-2-amine dihydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-(1-aminoethyl)pyridin-2-amine;dihydrochloride (CAS 2973762-68-2) is a chemical compound with the molecular formula C7H13Cl2N3 and a molecular weight of 210.10 g/mol. IUPAC name: 6-(1-aminoethyl)pyridin-2-amine;dihydrochloride. InChIKey: VDFHLRYHICQSQG-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3 |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 6-(1-aminoethyl)pyridin-2-amine;dihydrochloride |
| InChIKey | VDFHLRYHICQSQG-UHFFFAOYSA-N |
| SMILES | CC(C1=NC(=CC=C1)N)N.Cl.Cl |
Computed by PubChem (NCBI)