CAS 29808-81-9 appears in our catalog under these names: 2-Nitroacridine, 95%, 2-nitroacridine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-nitroacridine (CAS 29808-81-9) is a chemical compound with the molecular formula C13H8N2O2 and a molecular weight of 224.21 g/mol. IUPAC name: 2-nitroacridine. InChIKey: VAPQAGMSICPBKJ-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O2 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 2-nitroacridine |
| InChIKey | VAPQAGMSICPBKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=C(C=CC3=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)