CAS 887975-97-5 appears in our catalog under these names: 6-(3-Cyanophenyl)nicotinic acid, 95%, 6–(3–Cyanophenyl)nicotinic acid, 6-(3-Cyanophenyl)nicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
6-(3-cyanophenyl)pyridine-3-carboxylic acid (CAS 887975-97-5) is a chemical compound with the molecular formula C13H8N2O2 and a molecular weight of 224.21 g/mol. IUPAC name: 6-(3-cyanophenyl)pyridine-3-carboxylic acid. InChIKey: GKSSIPVARYBMTM-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O2 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 6-(3-cyanophenyl)pyridine-3-carboxylic acid |
| InChIKey | GKSSIPVARYBMTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=NC=C(C=C2)C(=O)O)C#N |
Computed by PubChem (NCBI)