Products 887981-96-6

CAS 887981-96-6 is the registry number for 6-(3-Cyanophenyl)picolinic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

6-(3-cyanophenyl)pyridine-2-carboxylic acid (CAS 887981-96-6) is a chemical compound with the molecular formula C13H8N2O2 and a molecular weight of 224.21 g/mol. IUPAC name: 6-(3-cyanophenyl)pyridine-2-carboxylic acid. InChIKey: ZCOZAVSZIZHBRG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8N2O2
Molecular weight224.21 g/mol
IUPAC name6-(3-cyanophenyl)pyridine-2-carboxylic acid
InChIKeyZCOZAVSZIZHBRG-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C2=NC(=CC=C2)C(=O)O)C#N

Computed by PubChem (NCBI)