CAS 31835-63-9 appears in our catalog under these names: 4-Cyano-4'-nitrodiphenyl, 95%, 4–Cyano–4'–nitrodiphenyl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 200mg.
4-(4-nitrophenyl)benzonitrile (CAS 31835-63-9) is a chemical compound with the molecular formula C13H8N2O2 and a molecular weight of 224.21 g/mol. IUPAC name: 4-(4-nitrophenyl)benzonitrile. InChIKey: QHWXJDVNOZETQM-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O2 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 4-(4-nitrophenyl)benzonitrile |
| InChIKey | QHWXJDVNOZETQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)