CAS 75898-34-9 appears in our catalog under these names: 4-Cyano-2'-nitrodiphenyl, 95%, 4–Cyano–2'–nitrodiphenyl, 4-Cyano-2'-nitrodiphenyl, >98.0%(GC), 4-Cyano-2'-nitrodiphenyl, ≥98%(GC), ≥98%(GC). Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 50mg, 5g.
4-(2-nitrophenyl)benzonitrile (CAS 75898-34-9) is a chemical compound with the molecular formula C13H8N2O2 and a molecular weight of 224.21 g/mol. IUPAC name: 4-(2-nitrophenyl)benzonitrile. InChIKey: LZUDBRIMDISCJM-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O2 |
|---|---|
| Molecular weight | 224.21 g/mol |
| IUPAC name | 4-(2-nitrophenyl)benzonitrile |
| InChIKey | LZUDBRIMDISCJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)