CAS 29809-14-1 appears in our catalog under these names: 5-Nitro-1,2,3,4-tetrahydronaphthalene, 95%, 5–Nitro–1,2,3,4–tetrahydronaphthalene, 5-Nitrotetralin, 98%, 98%, 5-Nitro-1,2,3,4-tetrahydronaphthalene, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-nitro-1,2,3,4-tetrahydronaphthalene (CAS 29809-14-1) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 5-nitro-1,2,3,4-tetrahydronaphthalene. InChIKey: VXZHOWCMXKLZNY-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5-nitro-1,2,3,4-tetrahydronaphthalene |
| InChIKey | VXZHOWCMXKLZNY-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)