Products 2982654-76-0
CAS 2982654-76-0 is the registry number for 5-Phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid (CAS 2982654-76-0) is a chemical compound with the molecular formula C13H9N3O2 and a molecular weight of 239.23 g/mol. IUPAC name: 5-phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: GTCYEEUCLAXSFF-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 5-phenyl-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | GTCYEEUCLAXSFF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=NC(=NN32)C(=O)O |
Computed by PubChem (NCBI)