CAS 2982794-86-3 is the registry number for Xanthine oxidase-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(3-cyano-1-propan-2-ylindol-5-yl)-1,2-oxazole-3-carboxylic acid (CAS 2982794-86-3) is a chemical compound with the molecular formula C16H13N3O3 and a molecular weight of 295.29 g/mol. IUPAC name: 5-(3-cyano-1-propan-2-ylindol-5-yl)-1,2-oxazole-3-carboxylic acid. InChIKey: QGDXRFMUFQUIQB-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O3 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | 5-(3-cyano-1-propan-2-ylindol-5-yl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | QGDXRFMUFQUIQB-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C2=C1C=CC(=C2)C3=CC(=NO3)C(=O)O)C#N |
Computed by PubChem (NCBI)