CAS 2982893-14-9 is the registry number for Tubulin polymerization-IN-84. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-methylphenyl)-8-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine (CAS 2982893-14-9) is a chemical compound with the molecular formula C23H22N2O3 and a molecular weight of 374.4 g/mol. IUPAC name: 2-(4-methylphenyl)-8-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine. InChIKey: MQOVOQHTDHUQBA-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 2-(4-methylphenyl)-8-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine |
| InChIKey | MQOVOQHTDHUQBA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CN3C=CC=C(C3=N2)C4=CC(=C(C(=C4)OC)OC)OC |
Computed by PubChem (NCBI)