CAS 29835-28-7 appears in our catalog under these names: 3–(3–Bromophenyl)prop–2–ynoic acid, 3-(3-Bromophenyl)prop-2-ynoic acid, 3-(3-Bromophenyl)prop-2-ynoic acid 95%, 3-(3-Bromophenyl)prop-2-ynoic acid, 95%, 95%, 3-(3-Bromophenyl)propiolic acid, 98%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g, 500mg, 25g.
3-(3-bromophenyl)prop-2-ynoic acid (CAS 29835-28-7) is a chemical compound with the molecular formula C9H5BrO2 and a molecular weight of 225.04 g/mol. IUPAC name: 3-(3-bromophenyl)prop-2-ynoic acid. InChIKey: SATQURHUBJUFTF-UHFFFAOYSA-N.
| Molecular formula | C9H5BrO2 |
|---|---|
| Molecular weight | 225.04 g/mol |
| IUPAC name | 3-(3-bromophenyl)prop-2-ynoic acid |
| InChIKey | SATQURHUBJUFTF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C#CC(=O)O |
Computed by PubChem (NCBI)