CAS 2985-80-0 is the registry number for 2-Benzoyl-5-chlorophenol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(4-chloro-2-hydroxyphenyl)-phenylmethanone (CAS 2985-80-0) is a chemical compound with the molecular formula C13H9ClO2 and a molecular weight of 232.66 g/mol. IUPAC name: (4-chloro-2-hydroxyphenyl)-phenylmethanone. InChIKey: JYFJHKRWGLEWKH-UHFFFAOYSA-N.
| Molecular formula | C13H9ClO2 |
|---|---|
| Molecular weight | 232.66 g/mol |
| IUPAC name | (4-chloro-2-hydroxyphenyl)-phenylmethanone |
| InChIKey | JYFJHKRWGLEWKH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=C(C=C2)Cl)O |
Computed by PubChem (NCBI)