CAS 29866-51-1 appears in our catalog under these names: 3-Bromo-2,6-dimethoxybenzaldehyde, 95%, 3-Bromo-2,6-dimethoxybenzaldehyde, 3-Bromo-2,6-dimethoxybenzaldehyde, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 2,5g.
3-bromo-2,6-dimethoxybenzaldehyde (CAS 29866-51-1) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-2,6-dimethoxybenzaldehyde. InChIKey: CTZDPLCWTYHSOR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-2,6-dimethoxybenzaldehyde |
| InChIKey | CTZDPLCWTYHSOR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)OC)C=O |
Computed by PubChem (NCBI)