Products 29909-00-0
CAS 29909-00-0 appears in our catalog under these names: L-Phenylalanine-d8, >95% (HPLC), DL-Phenyl-d5-alanine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, DL–3–Phenylalanine–d8, DL-3-Phenylalanine-d8, 99.90%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 25mg, 5mg, 0,25g, 0,1g, 100mg, 50mg, 25 mg, 50 mg.
2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid (CAS 29909-00-0) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 173.24 g/mol. IUPAC name: 2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid. InChIKey: COLNVLDHVKWLRT-INHGFZCOSA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 173.24 g/mol |
| IUPAC name | 2-amino-2,3,3-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
| InChIKey | COLNVLDHVKWLRT-INHGFZCOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])C([2H])(C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)