Products 2995288-37-2
CAS 2995288-37-2 is the registry number for 3'-(tert-Butoxycarbonyl)-[1,1'-biphenyl]-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]benzoic acid (CAS 2995288-37-2) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: 3-[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]benzoic acid. InChIKey: MVWHAIIJFPZFOZ-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | 3-[3-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]benzoic acid |
| InChIKey | MVWHAIIJFPZFOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)