CAS 29969-25-3 is the registry number for 3,4-Dihydro-5,7-dimethoxy-isoquinoline Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
5,7-dimethoxy-3,4-dihydroisoquinoline;hydrochloride (CAS 29969-25-3) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: 5,7-dimethoxy-3,4-dihydroisoquinoline;hydrochloride. InChIKey: LBHLPMNIGCSCLS-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | 5,7-dimethoxy-3,4-dihydroisoquinoline;hydrochloride |
| InChIKey | LBHLPMNIGCSCLS-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCN=C2)C(=C1)OC.Cl |
Computed by PubChem (NCBI)