Products 2997009-23-9
CAS 2997009-23-9 is the registry number for tert-butyl (2R)-2-(hydroxymethyl)-2-methylmorpholine-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (2R)-2-(hydroxymethyl)-2-methylmorpholine-4-carboxylate (CAS 2997009-23-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl (2R)-2-(hydroxymethyl)-2-methylmorpholine-4-carboxylate. InChIKey: PKRXUYDZTBMGSS-LLVKDONJSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl (2R)-2-(hydroxymethyl)-2-methylmorpholine-4-carboxylate |
| InChIKey | PKRXUYDZTBMGSS-LLVKDONJSA-N |
| SMILES | C[C@@]1(CN(CCO1)C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)