Products 3000561-53-2
CAS 3000561-53-2 is the registry number for (S)-3-(4-Bromobenzyl)pyrrolidine hydrochloride, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
(3S)-3-[(4-bromophenyl)methyl]pyrrolidine;hydrochloride (CAS 3000561-53-2) is a chemical compound with the molecular formula C11H15BrClN and a molecular weight of 276.60 g/mol. IUPAC name: (3S)-3-[(4-bromophenyl)methyl]pyrrolidine;hydrochloride. InChIKey: HUEHWKWIOTXRGH-HNCPQSOCSA-N.
| Molecular formula | C11H15BrClN |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | (3S)-3-[(4-bromophenyl)methyl]pyrrolidine;hydrochloride |
| InChIKey | HUEHWKWIOTXRGH-HNCPQSOCSA-N |
| SMILES | C1CNC[C@H]1CC2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)