CAS 30034-43-6 is the registry number for 7-Methoxy-4-phenyl-1,2-dihydroquinolin-2-one. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
7-methoxy-4-phenyl-1H-quinolin-2-one (CAS 30034-43-6) is a chemical compound with the molecular formula C16H13NO2 and a molecular weight of 251.28 g/mol. IUPAC name: 7-methoxy-4-phenyl-1H-quinolin-2-one. InChIKey: SASFZIYJZPZALO-UHFFFAOYSA-N.
| Molecular formula | C16H13NO2 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 7-methoxy-4-phenyl-1H-quinolin-2-one |
| InChIKey | SASFZIYJZPZALO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=O)N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)