CAS 30042-49-0 appears in our catalog under these names: 4-(4-Chlorophenyl)morpholine-2,6-dione, 95%, 4-(4-Chlorophenyl)morpholine-2,6-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(4-chlorophenyl)morpholine-2,6-dione (CAS 30042-49-0) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: 4-(4-chlorophenyl)morpholine-2,6-dione. InChIKey: ZFNBTNYQKIAOJE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | 4-(4-chlorophenyl)morpholine-2,6-dione |
| InChIKey | ZFNBTNYQKIAOJE-UHFFFAOYSA-N |
| SMILES | C1C(=O)OC(=O)CN1C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)