Products 300561-61-9
CAS 300561-61-9 is the registry number for (R)-SCH-23982 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(5R)-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride (CAS 300561-61-9) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: (5R)-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride. InChIKey: RHYVYDUSYMTHIF-UNTBIKODSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | (5R)-3-methyl-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-7-ol;hydrochloride |
| InChIKey | RHYVYDUSYMTHIF-UNTBIKODSA-N |
| SMILES | CN1CCC2=C(C=C(C=C2)O)[C@H](C1)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)