CAS 3007-23-6 appears in our catalog under these names: 1-(3-Methoxyphenyl)-1h-pyrrole-2,5-dione, 95%, 1-(3-Methoxyphenyl)-1H-pyrrole-2,5-dione, 95%, 95%, 1-(3-Methoxyphenyl)pyrrole-2,5-dione, 97%, 1-(3-Methoxyphenyl)-1H-pyrrole-2,5-dione, 95+%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg.
1-(3-methoxyphenyl)pyrrole-2,5-dione (CAS 3007-23-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 1-(3-methoxyphenyl)pyrrole-2,5-dione. InChIKey: UNCUTNPWBZKJHD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)pyrrole-2,5-dione |
| InChIKey | UNCUTNPWBZKJHD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)