CAS 301229-94-7 appears in our catalog under these names: 3-((3,4-Dimethylphenyl)amino)-2,3-dihydrothiophene 1,1-dioxide, 95%, N-(3,4-Dimethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
N-(3,4-dimethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (CAS 301229-94-7) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: N-(3,4-dimethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine. InChIKey: HJXYTODHBGFIKK-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| InChIKey | HJXYTODHBGFIKK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2CS(=O)(=O)C=C2)C |
Computed by PubChem (NCBI)