CAS 30131-16-9 appears in our catalog under these names: 4-(4-Phenylbutoxy)benzoic Acid, >95% (HPLC), 4–(4–Phenylbutoxy)benzoic Acid, 4-(4-Phenylbutoxy)benzoic acid, 4-(4-Phenylbutoxy)benzoic Acid, >98.0%(GC)(T), 4-(4-Phenylbutoxy)benzoic acid 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 250mg, 25mg, 50mg, 25g, 10g, 5g, 50g, 100g.
4-(4-phenylbutoxy)benzoic acid (CAS 30131-16-9) is a chemical compound with the molecular formula C17H18O3 and a molecular weight of 270.32 g/mol. IUPAC name: 4-(4-phenylbutoxy)benzoic acid. InChIKey: XWCWFMQMZZPALR-UHFFFAOYSA-N.
| Molecular formula | C17H18O3 |
|---|---|
| Molecular weight | 270.32 g/mol |
| IUPAC name | 4-(4-phenylbutoxy)benzoic acid |
| InChIKey | XWCWFMQMZZPALR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCCCOC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)