Products 3017174-74-9
CAS 3017174-74-9 is the registry number for Inonophenol C. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (2R)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-methyl-4-oxo-3H-pyran-2-carboxylate (CAS 3017174-74-9) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: methyl (2R)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-methyl-4-oxo-3H-pyran-2-carboxylate. InChIKey: DFMMAKIFFWIJII-LLCTXKFZSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | methyl (2R)-6-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]-2-methyl-4-oxo-3H-pyran-2-carboxylate |
| InChIKey | DFMMAKIFFWIJII-LLCTXKFZSA-N |
| SMILES | C[C@@]1(CC(=O)C=C(O1)/C=C/C2=CC(=C(C=C2)O)O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Inonophenol C