Products 30223-92-8
CAS 30223-92-8 is the registry number for Tyramine O-sulfate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(2-aminoethyl)phenyl] hydrogen sulfate (CAS 30223-92-8) is a chemical compound with the molecular formula C8H11NO4S and a molecular weight of 217.24 g/mol. IUPAC name: [4-(2-aminoethyl)phenyl] hydrogen sulfate. InChIKey: DYDUXGMDSXJQFT-UHFFFAOYSA-N.
| Molecular formula | C8H11NO4S |
|---|---|
| Molecular weight | 217.24 g/mol |
| IUPAC name | [4-(2-aminoethyl)phenyl] hydrogen sulfate |
| InChIKey | DYDUXGMDSXJQFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)OS(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Tyramine O-sulfate, tyramine sulfate, [4-(2-aminoethyl)phenyl] hydrogen sulfate, Phenol, 4-(2-aminoethyl)-, hydrogen sulfate (ester), (4-(2-aminoethyl)phenyl) hydrogen sulfate, (4-(2-azaniumylethyl)phenyl) sulfate, Tyramine-O-sulfate, 4-(2-aminoethyl)phenyl hydrogen sulfate, [4-(2-aminoethyl)phenyl]oxidanesulfonic acid, tyramine O-sulphate