Products 3026715-58-9
CAS 3026715-58-9 is the registry number for 2-(3,5-dimethylphenyl)propan-2-amine hydrochloride, 95%. Offered by: Chemat. Available pack sizes: 100mg.
2-(3,5-dimethylphenyl)propan-2-amine;hydrochloride (CAS 3026715-58-9) is a chemical compound with the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)propan-2-amine;hydrochloride. InChIKey: YZIFRNLGKHXTBG-UHFFFAOYSA-N.
| Molecular formula | C11H18ClN |
|---|---|
| Molecular weight | 199.72 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)propan-2-amine;hydrochloride |
| InChIKey | YZIFRNLGKHXTBG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(C)(C)N)C.Cl |
Computed by PubChem (NCBI)