CAS 303064-47-3 is the registry number for 3-Methyl-5-(phenoxymethyl)-2-furoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-methyl-5-(phenoxymethyl)furan-2-carboxylic acid (CAS 303064-47-3) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 3-methyl-5-(phenoxymethyl)furan-2-carboxylic acid. InChIKey: AJUGKZCPMRYOAV-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 3-methyl-5-(phenoxymethyl)furan-2-carboxylic acid |
| InChIKey | AJUGKZCPMRYOAV-UHFFFAOYSA-N |
| SMILES | CC1=C(OC(=C1)COC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)