Products 3031788-38-9
CAS 3031788-38-9 is the registry number for Methyl 3,5-Dihydroxy-2-nitrobenzoate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl 3,5-dihydroxy-2-nitrobenzoate (CAS 3031788-38-9) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: methyl 3,5-dihydroxy-2-nitrobenzoate. InChIKey: UHLNTUNVQIDXBC-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | methyl 3,5-dihydroxy-2-nitrobenzoate |
| InChIKey | UHLNTUNVQIDXBC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)