Products 3031799-54-6
CAS 3031799-54-6 is the registry number for 1-methyl-4-[3-(1-methylpyrazol-4-yl)phenyl]pyrazole, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-methyl-4-[3-(1-methylpyrazol-4-yl)phenyl]pyrazole (CAS 3031799-54-6) is a chemical compound with the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. IUPAC name: 1-methyl-4-[3-(1-methylpyrazol-4-yl)phenyl]pyrazole. InChIKey: VPYBUGIIIOMCIB-UHFFFAOYSA-N.
| Molecular formula | C14H14N4 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 1-methyl-4-[3-(1-methylpyrazol-4-yl)phenyl]pyrazole |
| InChIKey | VPYBUGIIIOMCIB-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CC(=CC=C2)C3=CN(N=C3)C |
Computed by PubChem (NCBI)