Products 3032629-09-4
CAS 3032629-09-4 is the registry number for Antitubercular agent-11. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-tert-butylphenyl)-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole (CAS 3032629-09-4) is a chemical compound with the molecular formula C16H15N3O4 and a molecular weight of 313.31 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole. InChIKey: FMFHWUVCEUBEHG-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O4 |
|---|---|
| Molecular weight | 313.31 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-5-(5-nitrofuran-2-yl)-1,3,4-oxadiazole |
| InChIKey | FMFHWUVCEUBEHG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(O2)C3=CC=C(O3)[N+](=O)[O-] |
Computed by PubChem (NCBI)