Products 3033806-97-9
CAS 3033806-97-9 is the registry number for NDs-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3,4-dimethoxyphenyl)-5,6-dihydrobenzo[h]cinnoline (CAS 3033806-97-9) is a chemical compound with the molecular formula C20H18N2O2 and a molecular weight of 318.4 g/mol. IUPAC name: 3-(3,4-dimethoxyphenyl)-5,6-dihydrobenzo[h]cinnoline. InChIKey: HPAQZIBAUYQOIW-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O2 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 3-(3,4-dimethoxyphenyl)-5,6-dihydrobenzo[h]cinnoline |
| InChIKey | HPAQZIBAUYQOIW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NN=C3C(=C2)CCC4=CC=CC=C43)OC |
Computed by PubChem (NCBI)
Synonyms:
NDs-IN-1, orb2567306